* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FURISYL |
CAS: | 72239-53-3 |
English Synonyms: | FURISYL |
MDL Number.: | MFCD01730240 |
H bond acceptor: | 10 |
H bond donor: | 2 |
Smile: | c1cc(oc1)C2OCC(CO2)(CO)Nc3nc(nc(n3)N4CC4)N5CC5 |
InChi: | InChI=1S/C16H20N6O4/c23-8-16(9-25-12(26-10-16)11-2-1-7-24-11)20-13-17-14(21-3-4-21)19-15(18-13)22-5-6-22/h1-2,7,12,23H,3-6,8-10H2,(H,17,18,19,20) |
InChiKey: | InChIKey=PNUBYEKZUBFUQS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.