* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GRAHAMIMYCIN A |
CAS: | 76023-57-9 |
English Synonyms: | GRAHAMIMYCIN A |
MDL Number.: | MFCD01730319 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | C[C@@H]1C/C=C/C(=O)O[C@H](C[C@H](C(=O)/C=C/C(=O)O1)O)C |
InChi: | InChI=1S/C14H18O6/c1-9-4-3-5-13(17)20-10(2)8-12(16)11(15)6-7-14(18)19-9/h3,5-7,9-10,12,16H,4,8H2,1-2H3/b5-3+,7-6+/t9-,10+,12-/m1/s1 |
InChiKey: | InChIKey=CZZDNDKEYUQSIO-ODQGAGOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.