* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | YS-23 |
| CAS: | 100427-85-8 |
| English Synonyms: | YS-23 |
| MDL Number.: | MFCD01732471 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CCN(CC)C(CCc1ccccc1Cl)c2ccccc2 |
| InChi: | InChI=1S/C19H24ClN/c1-3-21(4-2)19(17-11-6-5-7-12-17)15-14-16-10-8-9-13-18(16)20/h5-13,19H,3-4,14-15H2,1-2H3 |
| InChiKey: | InChIKey=RKGSZCNVIWEFLZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.