* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | JFA 10 |
CAS: | 100427-84-7 |
English Synonyms: | JFA 10 |
MDL Number.: | MFCD01732534 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CCN(CCI)Cc1ccc(cc1)Cl.I |
InChi: | InChI=1S/C11H15ClIN.HI/c1-2-14(8-7-13)9-10-3-5-11(12)6-4-10;/h3-6H,2,7-9H2,1H3;1H |
InChiKey: | InChIKey=GGSYODXMYCDVKX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.