* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ACETAMIDE, N-(5-(1,3-BENZODIOXOL-5-YL)-1,3,4-OXADIAZOL-2-YL)- |
CAS: | 83805-44-1 |
English Synonyms: | N-(5-(1,3-BENZODIOXOL-5-YL)-1,3,4-OXADIAZOL-2-YL)-ACETAMIDE ; ACETAMIDE, N-(5-(1,3-BENZODIOXOL-5-YL)-1,3,4-OXADIAZOL-2-YL)- |
MDL Number.: | MFCD01733358 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | CC(=O)Nc1nnc(o1)c2ccc3c(c2)OCO3 |
InChi: | InChI=1S/C11H9N3O4/c1-6(15)12-11-14-13-10(18-11)7-2-3-8-9(4-7)17-5-16-8/h2-4H,5H2,1H3,(H,12,14,15) |
InChiKey: | InChIKey=ABEDTIBSDLMYFY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.