* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VESAMICOL |
CAS: | 22232-64-0 |
English Synonyms: | VESAMICOL |
MDL Number.: | MFCD01734973 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)C2CCN(CC2)[C@@H]3CCCC[C@H]3O |
InChi: | InChI=1S/C17H25NO/c19-17-9-5-4-8-16(17)18-12-10-15(11-13-18)14-6-2-1-3-7-14/h1-3,6-7,15-17,19H,4-5,8-13H2/t16-,17-/m1/s1 |
InChiKey: | InChIKey=YSSBJODGIYRAMI-IAGOWNOFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.