* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FLUROCITABINE |
CAS: | 37717-21-8 |
English Synonyms: | FLUROCITABINE |
MDL Number.: | MFCD01735933 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | c1c(c(=N)nc2n1[C@H]3[C@@H](O2)[C@@H]([C@H](O3)CO)O)F |
InChi: | InChI=1S/C9H10FN3O4/c10-3-1-13-8-6(5(15)4(2-14)16-8)17-9(13)12-7(3)11/h1,4-6,8,11,14-15H,2H2/t4-,5-,6+,8-/m1/s1 |
InChiKey: | InChIKey=PAYBYKKERMGTSS-MNCSTQPFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.