* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | AMK 324 |
CAS: | 80171-74-0 |
English Synonyms: | AMK 324 |
MDL Number.: | MFCD01739342 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCOCc1cccc(c1)NC(=O)OCCN2CCCCC2.Cl |
InChi: | InChI=1S/C17H26N2O3.ClH/c1-2-21-14-15-7-6-8-16(13-15)18-17(20)22-12-11-19-9-4-3-5-10-19;/h6-8,13H,2-5,9-12,14H2,1H3,(H,18,20);1H |
InChiKey: | InChIKey=MLKPNZDYLINQAO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.