* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | AMK 353 |
CAS: | 80171-65-9 |
English Synonyms: | AMK 353 |
MDL Number.: | MFCD01739573 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCCCCOCc1cccc(c1)NC(=O)OCCN2CCCC2.Cl |
InChi: | InChI=1S/C19H30N2O3.ClH/c1-2-3-6-13-23-16-17-8-7-9-18(15-17)20-19(22)24-14-12-21-10-4-5-11-21;/h7-9,15H,2-6,10-14,16H2,1H3,(H,20,22);1H |
InChiKey: | InChIKey=XEBHBKKFIPXVSZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.