* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9H-CARBAZOL-2-AMINE |
CAS: | 4539-51-9 |
English Synonyms: | 2-AMINOCARBAZOLE ; 9H-CARBAZOL-2-AMINE |
MDL Number.: | MFCD01739769 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | c1ccc2c(c1)c3ccc(cc3[nH]2)N |
InChi: | InChI=1S/C12H10N2/c13-8-5-6-10-9-3-1-2-4-11(9)14-12(10)7-8/h1-7,14H,13H2 |
InChiKey: | InChIKey=IGLKULAEHPBIJL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.