* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DIOSPYRIN |
| CAS: | 28164-57-0 |
| English Synonyms: | DIOSPYRIN |
| MDL Number.: | MFCD01740313 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | Cc1cc2c(c(c1)O)C(=O)C=C(C2=O)c3c(cc4c(c3O)C(=O)C=CC4=O)C |
| InChi: | InChI=1S/C22H14O6/c1-9-5-12-19(16(25)6-9)17(26)8-13(21(12)27)18-10(2)7-11-14(23)3-4-15(24)20(11)22(18)28/h3-8,25,28H,1-2H3 |
| InChiKey: | InChIKey=WRFTYMHHWSAKSK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.