* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ENT-51143 |
CAS: | 16274-54-7 |
English Synonyms: | ENT-51143 |
MDL Number.: | MFCD01743074 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | C1COCCN1c2nc(nc(n2)N)N.Cl |
InChi: | InChI=1S/C7H12N6O.ClH/c8-5-10-6(9)12-7(11-5)13-1-3-14-4-2-13;/h1-4H2,(H4,8,9,10,11,12);1H |
InChiKey: | InChIKey=XYXBVTFKRUIMQV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.