* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | R-(+)-THIOPENTAL SODIUM |
CAS: | 51165-38-9 |
English Synonyms: | R-(+)-THIOPENTAL SODIUM |
MDL Number.: | MFCD01744079 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCC[C@@H](C)C1(C(=O)NC(=S)N(C1=O)[Na])CC |
InChi: | InChI=1S/C11H18N2O2S.Na/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15;/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16);/q;+1/p-1/t7-;/m1./s1 |
InChiKey: | InChIKey=AWLILQARPMWUHA-OGFXRTJISA-M |
* If the product has intellectual property rights, a license granted is must or contact us.