* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RA VII |
| CAS: | 86229-97-2 |
| English Synonyms: | RA VII |
| MDL Number.: | MFCD01745053 |
| H bond acceptor: | 16 |
| H bond donor: | 4 |
| Smile: | C[C@H]1C(=O)N[C@@H](C(=O)N([C@H](C(=O)N[C@@H](C(=O)N([C@H]2Cc3ccc(cc3)Oc4cc(ccc4OC)C([C@@H](C(=O)N1)N(C2=O)C)O)C)C)Cc5ccc(cc5)OC)C)C |
| InChi: | InChI=1S/C41H50N6O10/c1-22-36(49)43-23(2)39(52)45(4)30(19-25-9-14-28(55-7)15-10-25)37(50)44-24(3)40(53)46(5)31-20-26-11-16-29(17-12-26)57-33-21-27(13-18-32(33)56-8)35(48)34(38(51)42-22)47(6)41(31)54/h9-18,21-24,30-31,34-35,48H,19-20H2,1-8H3,(H,42,51)(H,43,49)(H,44,50)/t22-,23+,24+,30-,31-,34-,35?/m0/s1 |
| InChiKey: | InChIKey=SBXOCFQJHBHXMM-LNEUMCTNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.