* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GUABENXANE |
| CAS: | 17471-82-8 |
| English Synonyms: | GUABENXANE |
| MDL Number.: | MFCD01746689 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | c1cc2c(cc1CNC(=N)N)OCCO2.c1cc2c(cc1CNC(=N)N)OCCO2.OS(=O)(=O)O |
| InChi: | InChI=1S/2C10H13N3O2.H2O4S/c2*11-10(12)13-6-7-1-2-8-9(5-7)15-4-3-14-8;1-5(2,3)4/h2*1-2,5H,3-4,6H2,(H4,11,12,13);(H2,1,2,3,4) |
| InChiKey: | InChIKey=LSNRHCLNQZVRQD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.