* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IGNAVINE |
CAS: | 1357-76-2 |
English Synonyms: | IGNAVINE |
MDL Number.: | MFCD01746792 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | C[C@]12CN3[C@@H]4[C@H]1[C@@]5(C3C6C[C@H]7C[C@@]5([C@]6(C4)[C@@H](C7=C)O)O)C[C@H]([C@@H]2O)OC(=O)c8ccccc8 |
InChi: | InChI=1S/C27H31NO5/c1-13-15-8-16-20-26-11-18(33-23(31)14-6-4-3-5-7-14)22(30)24(2)12-28(20)17(19(24)26)10-25(16,21(13)29)27(26,32)9-15/h3-7,15-22,29-30,32H,1,8-12H2,2H3/t15-,16?,17-,18+,19+,20?,21+,22-,24-,25-,26+,27-/m0/s1 |
InChiKey: | InChIKey=FOIZZXKAYVIZQC-GSBNQQKRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.