* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | INDOLMYCIN |
CAS: | 21200-24-8 |
English Synonyms: | INDOLMYCIN |
MDL Number.: | MFCD01747966 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | C[C@H](c1c[nH]c2c1cccc2)[C@H]3C(=O)N=C(O3)NC |
InChi: | InChI=1S/C14H15N3O2/c1-8(12-13(18)17-14(15-2)19-12)10-7-16-11-6-4-3-5-9(10)11/h3-8,12,16H,1-2H3,(H,15,17,18)/t8-,12+/m1/s1 |
InChiKey: | InChIKey=GNTVWGDQPXCYBV-PELKAZGASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.