* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ESTATIN B |
| CAS: | 106396-24-1 |
| English Synonyms: | ESTATIN B |
| MDL Number.: | MFCD01747978 |
| H bond acceptor: | 11 |
| H bond donor: | 7 |
| Smile: | c1cc(ccc1CC(C(=O)NCCCCNC(=N)N)NC(=O)C2C(O2)C(=O)O)O |
| InChi: | InChI=1S/C18H25N5O6/c19-18(20)22-8-2-1-7-21-15(25)12(9-10-3-5-11(24)6-4-10)23-16(26)13-14(29-13)17(27)28/h3-6,12-14,24H,1-2,7-9H2,(H,21,25)(H,23,26)(H,27,28)(H4,19,20,22) |
| InChiKey: | InChIKey=IVRMXEFFYRZNCU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.