* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WR 226253 |
CAS: | 76487-48-4 |
English Synonyms: | WR 226253 |
MDL Number.: | MFCD01749975 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CS(=O)(=O)O.c1c(cc(c2c1c(cc(n2)C(F)(F)F)C(C3CCCCN3)O)Cl)Cl.O |
InChi: | InChI=1S/C16H15Cl2F3N2O.CH4O3S.H2O/c17-8-5-9-10(15(24)12-3-1-2-4-22-12)7-13(16(19,20)21)23-14(9)11(18)6-8;1-5(2,3)4;/h5-7,12,15,22,24H,1-4H2;1H3,(H,2,3,4);1H2 |
InChiKey: | InChIKey=SMMXTKZNAJFGBF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.