* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RORIDIND |
| CAS: | 14682-29-2 |
| English Synonyms: | RORIDIND |
| MDL Number.: | MFCD01750936 |
| H bond acceptor: | 9 |
| H bond donor: | 1 |
| Smile: | CC1=C[C@@H]2[C@@]3(CC1)COC(=O)[C@@H]4[C@@](O4)(CCOC(/C=C/C=C\C(=O)O[C@H]5[C@]3([C@]6(CO6)[C@@H](C5)O2)C)C(C)O)C |
| InChi: | InChI=1S/C29H38O9/c1-17-9-10-28-15-34-25(32)24-26(3,38-24)11-12-33-19(18(2)30)7-5-6-8-23(31)37-20-14-22(36-21(28)13-17)29(16-35-29)27(20,28)4/h5-8,13,18-22,24,30H,9-12,14-16H2,1-4H3/b7-5+,8-6-/t18?,19?,20-,21-,22-,24-,26+,27-,28-,29+/m1/s1 |
| InChiKey: | InChIKey=XZWOQFZHIMDODQ-IREANEMASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.