* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FROLON |
| CAS: | 21958-17-8 |
| English Synonyms: | FROLON |
| MDL Number.: | MFCD01753063 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CCCCOc1ccc(cc1)C2C(=C(C(=O)O2)Br)Br |
| InChi: | InChI=1S/C14H14Br2O3/c1-2-3-8-18-10-6-4-9(5-7-10)13-11(15)12(16)14(17)19-13/h4-7,13H,2-3,8H2,1H3 |
| InChiKey: | InChIKey=CLGNSHMVZBJLJV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.