* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VALIDOXYLAMINE B |
CAS: | 39318-73-5 |
English Synonyms: | VALIDOXYLAMINE B |
MDL Number.: | MFCD01754187 |
H bond acceptor: | 10 |
H bond donor: | 10 |
Smile: | C1=C([C@H]([C@@H]([C@H]([C@H]1N[C@H]2[C@@H]([C@@H]([C@H]([C@@H]([C@H]2O)O)O)CO)O)O)O)O)CO |
InChi: | InChI=1S/C14H25NO9/c16-2-4-1-6(11(21)13(23)8(4)18)15-7-9(19)5(3-17)10(20)14(24)12(7)22/h1,5-24H,2-3H2/t5-,6-,7-,8+,9+,10+,11-,12-,13-,14-/m0/s1 |
InChiKey: | InChIKey=OTSKEODGNQKECL-WSRAPPRJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.