* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUINOLINE7,8-OXIDE |
| CAS: | 130536-39-9 |
| English Synonyms: | 1AH,7BH-OXIRENO[2,3-H]QUINOLINE ; QUINOLINE7,8-OXIDE |
| MDL Number.: | MFCD01755346 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | c1cc2c(nc1)C3C(O3)C=C2 |
| InChi: | InChI=1S/C9H7NO/c1-2-6-3-4-7-9(11-7)8(6)10-5-1/h1-5,7,9H |
| InChiKey: | InChIKey=VHKOGTWROZZNFC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.