* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-EPIMITOMYCIN D |
CAS: | 79026-43-0 |
English Synonyms: | 9-EPIMITOMYCIN D |
MDL Number.: | MFCD01757349 |
H bond acceptor: | 9 |
H bond donor: | 3 |
Smile: | CC1=C(C(=O)C2=C(C1=O)N3C[C@H]4[C@@H]([C@@]3([C@@H]2COC(=O)N)O)N4C)N |
InChi: | InChI=1S/C15H18N4O5/c1-5-9(16)12(21)8-6(4-24-14(17)22)15(23)13-7(18(13)2)3-19(15)10(8)11(5)20/h6-7,13,23H,3-4,16H2,1-2H3,(H2,17,22)/t6-,7+,13+,15-,18?/m1/s1 |
InChiKey: | InChIKey=JHIATKDBEBOOCO-NTMSUYENSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.