* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2H-2,3,4,7,9-PENTAMETHYL-2,4-DIHYDROPYRAZOLO(4,3-C)PYRIDO(3,2-E)-1,2-T HIAZINE-5,5-DIOXIDE |
| CAS: | 162255-91-6 |
| English Synonyms: | 2H-2,3,4,7,9-PENTAMETHYL-2,4-DIHYDROPYRAZOLO(4,3-C)PYRIDO(3,2-E)-1,2-T HIAZINE-5,5-DIOXIDE |
| MDL Number.: | MFCD01758216 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | Cc1cc(nc2c1-c3c(c(n(n3)C)C)N(S2(=O)=O)C)C |
| InChi: | InChI=1S/C13H16N4O2S/c1-7-6-8(2)14-13-10(7)11-12(9(3)16(4)15-11)17(5)20(13,18)19/h6H,1-5H3 |
| InChiKey: | InChIKey=UZPQMGJSLNHDNH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.