* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WOOL WHITENER WG |
English Synonyms: | WOOL WHITENER WG |
MDL Number.: | MFCD01762134 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)C2CC(=NN2c3ccc(cc3)S(=O)(=O)[O-])c4ccc(cc4)Cl.[Na+] |
InChi: | InChI=1S/C21H17ClN2O3S.Na/c22-17-8-6-15(7-9-17)20-14-21(16-4-2-1-3-5-16)24(23-20)18-10-12-19(13-11-18)28(25,26)27;/h1-13,21H,14H2,(H,25,26,27);/q;+1/p-1 |
InChiKey: | InChIKey=UTJLWJQDJWWHIB-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.