* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-ETHOXY-6-(3-METHYL-2-BUTENYL)-3-(1H-TETRAZOL-5-YL)-2H-1-BENZOPYRAN-2-ONE |
CAS: | 76239-49-1 |
English Synonyms: | 7-ETHOXY-6-(3-METHYL-2-BUTENYL)-3-(1H-TETRAZOL-5-YL)-2H-1-BENZOPYRAN-2-ONE |
MDL Number.: | MFCD01762836 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | CCOc1cc2c(cc1CC=C(C)C)cc(c(=O)o2)c3[nH]nnn3 |
InChi: | InChI=1S/C17H18N4O3/c1-4-23-14-9-15-12(7-11(14)6-5-10(2)3)8-13(17(22)24-15)16-18-20-21-19-16/h5,7-9H,4,6H2,1-3H3,(H,18,19,20,21) |
InChiKey: | InChIKey=ACJONDVTWOHKQG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.