* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 1469410 |
| English Synonyms: | EMOLECULES 1469410 ; ZERENEX E/6022205 |
| MDL Number.: | MFCD01788367 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CCc1nnc(s1)NC(=O)c2ccc3c(c2)nsn3 |
| InChi: | InChI=1S/C11H9N5OS2/c1-2-9-13-14-11(18-9)12-10(17)6-3-4-7-8(5-6)16-19-15-7/h3-5H,2H2,1H3,(H,12,14,17) |
| InChiKey: | InChIKey=NPKFGEWXABAZSM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.