* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB035577 |
| English Synonyms: | VITAS-BB TBB035577 |
| MDL Number.: | MFCD01823524 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCCOC(=O)C1=C(C)NC2=C(C1C1=C(Br)C=CC=C1)C(=O)CCC2 |
| InChi: | InChI=1S/C20H22BrNO3/c1-3-11-25-20(24)17-12(2)22-15-9-6-10-16(23)19(15)18(17)13-7-4-5-8-14(13)21/h4-5,7-8,18,22H,3,6,9-11H2,1-2H3 |
| InChiKey: | InChIKey=OUHONBWMSRSLLW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.