* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB035617 |
| English Synonyms: | VITAS-BB TBB035617 |
| MDL Number.: | MFCD01823961 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | [H]C12CC3([H])CC([H])(C1)CC(C2)(C3)C(=O)NC1=C(C(=O)OCC)C(C)=C(S1)C(=O)NC1=CC(OC)=CC=C1 |
| InChi: | InChI=1S/C27H32N2O5S/c1-4-34-25(31)21-15(2)22(23(30)28-19-6-5-7-20(11-19)33-3)35-24(21)29-26(32)27-12-16-8-17(13-27)10-18(9-16)14-27/h5-7,11,16-18H,4,8-10,12-14H2,1-3H3,(H,28,30)(H,29,32) |
| InChiKey: | InChIKey=LNJXCFMGKQUYQR-HYVKCOOLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.