* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB035619 |
| English Synonyms: | VITAS-BB TBB035619 |
| MDL Number.: | MFCD01823963 |
| H bond acceptor: | 9 |
| H bond donor: | 2 |
| Smile: | CCOC(=O)C1=C(NC(=O)C2=CC=C(C)C(=C2)[N+]([O-])=O)SC(C(=O)NC2=CC=CC=C2C)=C1C |
| InChi: | InChI=1S/C24H23N3O6S/c1-5-33-24(30)19-15(4)20(22(29)25-17-9-7-6-8-13(17)2)34-23(19)26-21(28)16-11-10-14(3)18(12-16)27(31)32/h6-12H,5H2,1-4H3,(H,25,29)(H,26,28) |
| InChiKey: | InChIKey=BUATUOGMNFZDFD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.