* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB035628 |
English Synonyms: | VITAS-BB TBB035628 |
MDL Number.: | MFCD01824306 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | COC1=CC=CC(=C1)C1C(C(=O)OC2CCCCC2)=C(C)NC2=C1C(=O)CC(C2)C1=CC=C(Cl)C=C1 |
InChi: | InChI=1S/C30H32ClNO4/c1-18-27(30(34)36-23-8-4-3-5-9-23)28(20-7-6-10-24(15-20)35-2)29-25(32-18)16-21(17-26(29)33)19-11-13-22(31)14-12-19/h6-7,10-15,21,23,28,32H,3-5,8-9,16-17H2,1-2H3 |
InChiKey: | InChIKey=DKDMMELIASVPAY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.