* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB035639 |
| English Synonyms: | VITAS-BB TBB035639 |
| MDL Number.: | MFCD01824508 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | COC1=C(OC)C(OC)=C(C=C1)C1C(C(=O)OC2CCCCCC2)=C(C)NC2=C1C(=O)CC(C)(C)C2 |
| InChi: | InChI=1S/C29H39NO6/c1-17-23(28(32)36-18-11-9-7-8-10-12-18)24(25-20(30-17)15-29(2,3)16-21(25)31)19-13-14-22(33-4)27(35-6)26(19)34-5/h13-14,18,24,30H,7-12,15-16H2,1-6H3 |
| InChiKey: | InChIKey=CUYMSKZDAIEZDM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.