* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB035658 |
| English Synonyms: | VITAS-BB TBB035658 |
| MDL Number.: | MFCD01825129 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CN1C(=O)NC(C2=CC=C(Br)S2)C(C(=O)OCCC2=CC=CC=C2)=C1C |
| InChi: | InChI=1S/C19H19BrN2O3S/c1-12-16(18(23)25-11-10-13-6-4-3-5-7-13)17(21-19(24)22(12)2)14-8-9-15(20)26-14/h3-9,17H,10-11H2,1-2H3,(H,21,24) |
| InChiKey: | InChIKey=JPXOMGQGEYJYOD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.