* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB016709 |
| English Synonyms: | VITAS-BB TBB016709 |
| MDL Number.: | MFCD01825177 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CCOC(=O)C1=C(NC(=O)C2=CC=CC(Cl)=C2)SC(C(=O)NC2=CC=CC=C2C(F)(F)F)=C1C |
| InChi: | InChI=1S/C23H18ClF3N2O4S/c1-3-33-22(32)17-12(2)18(20(31)28-16-10-5-4-9-15(16)23(25,26)27)34-21(17)29-19(30)13-7-6-8-14(24)11-13/h4-11H,3H2,1-2H3,(H,28,31)(H,29,30) |
| InChiKey: | InChIKey=UAMLHZYBVGHCBO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.