* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB019161 |
| English Synonyms: | VITAS-BB TBB019161 |
| MDL Number.: | MFCD01825740 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | [H]C12CC3([H])CC([H])(C1)CC(C2)(C3)C(=O)NC1=CC=CC(Cl)=C1 |
| InChi: | InChI=1S/C17H20ClNO/c18-14-2-1-3-15(7-14)19-16(20)17-8-11-4-12(9-17)6-13(5-11)10-17/h1-3,7,11-13H,4-6,8-10H2,(H,19,20) |
| InChiKey: | InChIKey=OWEPCGATVXVIDJ-FBBPANFNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.