* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB025164 |
| English Synonyms: | VITAS-BB TBB025164 |
| MDL Number.: | MFCD01834608 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CCC(C)(C)C1CCC2=C(C1)SC(NC(=O)C(C)(C)C)=C2C(N)=O |
| InChi: | InChI=1S/C19H30N2O2S/c1-7-19(5,6)11-8-9-12-13(10-11)24-16(14(12)15(20)22)21-17(23)18(2,3)4/h11H,7-10H2,1-6H3,(H2,20,22)(H,21,23) |
| InChiKey: | InChIKey=DSDHDPACYCJGPZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.