* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB018169 |
| English Synonyms: | VITAS-BB TBB018169 |
| MDL Number.: | MFCD01834984 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | ClC1=CC=C(\C=C\C(=O)N2CCCC3=CC=CC=C23)C(Cl)=C1 |
| InChi: | InChI=1S/C18H15Cl2NO/c19-15-9-7-13(16(20)12-15)8-10-18(22)21-11-3-5-14-4-1-2-6-17(14)21/h1-2,4,6-10,12H,3,5,11H2/b10-8+ |
| InChiKey: | InChIKey=NICHOBRVVYVDRT-CSKARUKUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.