* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB023270 |
| English Synonyms: | VITAS-BB TBB023270 |
| MDL Number.: | MFCD01835137 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CCOC(=O)C1=C(NC(=O)C2CCCCC2C(O)=O)SC2=C1CCC(C)C2 |
| InChi: | InChI=1S/C20H27NO5S/c1-3-26-20(25)16-14-9-8-11(2)10-15(14)27-18(16)21-17(22)12-6-4-5-7-13(12)19(23)24/h11-13H,3-10H2,1-2H3,(H,21,22)(H,23,24) |
| InChiKey: | InChIKey=KNTLMNCJNFJXAY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.