* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHYL 4-((3,5-DIOXO-2,3,4,5-TETRAHYDRO-1,2,4-TRIAZIN-6-YL)THIO)-3-OXOBUTANOATE |
| English Synonyms: | ETHYL 4-((3,5-DIOXO-2,3,4,5-TETRAHYDRO-1,2,4-TRIAZIN-6-YL)THIO)-3-OXOBUTANOATE |
| MDL Number.: | MFCD01847370 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | CCOC(=O)CC(=O)CSc1c(=O)[nH]c(=O)[nH]n1 |
| InChi: | InChI=1S/C9H11N3O5S/c1-2-17-6(14)3-5(13)4-18-8-7(15)10-9(16)12-11-8/h2-4H2,1H3,(H2,10,12,15,16) |
| InChiKey: | InChIKey=GUWWCSDGACHNRJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.