* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ET 2(((2,6-DI-ME-PHENOXY)AC)AMINO)6-ME-4,5,6,7-4H-1-BENZOTHIOPHENE-3-CARBOXYLATE |
| English Synonyms: | ET 2(((2,6-DI-ME-PHENOXY)AC)AMINO)6-ME-4,5,6,7-4H-1-BENZOTHIOPHENE-3-CARBOXYLATE |
| MDL Number.: | MFCD01847951 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCOC(=O)c1c2c(sc1NC(=O)COc3c(cccc3C)C)CC(CC2)C |
| InChi: | InChI=1S/C22H27NO4S/c1-5-26-22(25)19-16-10-9-13(2)11-17(16)28-21(19)23-18(24)12-27-20-14(3)7-6-8-15(20)4/h6-8,13H,5,9-12H2,1-4H3,(H,23,24) |
| InChiKey: | InChIKey=PDZAQIXDXXBLFA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.