* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 13728663 |
| English Synonyms: | EMOLECULES 13728663 ; SPECS 907/25004331 |
| MDL Number.: | MFCD01859719 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | c1[n-]c2c(n1)c(ncn2)Cl |
| InChi: | InChI=1S/C5H2ClN4/c6-4-3-5(9-1-7-3)10-2-8-4/h1-2H/q-1 |
| InChiKey: | InChIKey=VTQXNBMGNCJHQQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.