* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 13728687 |
| English Synonyms: | EMOLECULES 13728687 ; SPECS 907/25004576 |
| MDL Number.: | MFCD01859737 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CCOc1ccnc(n1)[O-] |
| InChi: | InChI=1S/C6H8N2O2/c1-2-10-5-3-4-7-6(9)8-5/h3-4H,2H2,1H3,(H,7,8,9)/p-1 |
| InChiKey: | InChIKey=NPWARRDBZOQWSE-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.