* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 13733864 |
| English Synonyms: | EMOLECULES 13733864 ; SPECS 907/25005280 |
| MDL Number.: | MFCD01859783 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | Cc1cc(c2c(c1)ccc3[n+]2cccc3)C |
| InChi: | InChI=1S/C15H14N/c1-11-9-12(2)15-13(10-11)6-7-14-5-3-4-8-16(14)15/h3-10H,1-2H3/q+1 |
| InChiKey: | InChIKey=XSOWBIFZHQDSMT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.