* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | EMOLECULES 13735211 |
English Synonyms: | EMOLECULES 13735211 ; SPECS 333/25006216 |
MDL Number.: | MFCD01860170 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | c1cc2c(noc2nc1)[O-] |
InChi: | InChI=1S/C6H4N2O2/c9-5-4-2-1-3-7-6(4)10-8-5/h1-3H,(H,8,9)/p-1 |
InChiKey: | InChIKey=VHMSVJIBCHFSKU-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.