* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FMOC-D,L-PHE(4-CH2-CN) |
English Synonyms: | FMOC-D,L-PHE(4-CH2-CN) |
MDL Number.: | MFCD01860377 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1ccc2c(c1)-c3ccccc3C2COC(=O)NC(Cc4ccc(cc4)CC#N)C(=O)O |
InChi: | InChI=1S/C26H22N2O4/c27-14-13-17-9-11-18(12-10-17)15-24(25(29)30)28-26(31)32-16-23-21-7-3-1-5-19(21)20-6-2-4-8-22(20)23/h1-12,23-24H,13,15-16H2,(H,28,31)(H,29,30) |
InChiKey: | InChIKey=PVWDVTRWKBTEFH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.