* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FMOC-D, L-(2,6-DI-ME)TYR |
English Synonyms: | FMOC-D, L-(2,6-DI-ME)TYR |
MDL Number.: | MFCD01860471 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | Cc1cc(cc(c1CC(C(=O)O)NC(=O)OCC2c3ccccc3-c4c2cccc4)C)O |
InChi: | InChI=1S/C26H25NO5/c1-15-11-17(28)12-16(2)22(15)13-24(25(29)30)27-26(31)32-14-23-20-9-5-3-7-18(20)19-8-4-6-10-21(19)23/h3-12,23-24,28H,13-14H2,1-2H3,(H,27,31)(H,29,30) |
InChiKey: | InChIKey=RHSSAHKTHNKPGU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.