* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FMOC-D,L-HLYS(BOC) |
| CAS: | 194718-17-7 |
| English Synonyms: | FMOC-D,L-HLYS(BOC) |
| MDL Number.: | MFCD01860499 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | CC(C)(C)OC(=O)NCCCCCC(C(=O)O)NC(=O)OCC1c2ccccc2-c3c1cccc3 |
| InChi: | InChI=1S/C27H34N2O6/c1-27(2,3)35-25(32)28-16-10-4-5-15-23(24(30)31)29-26(33)34-17-22-20-13-8-6-11-18(20)19-12-7-9-14-21(19)22/h6-9,11-14,22-23H,4-5,10,15-17H2,1-3H3,(H,28,32)(H,29,33)(H,30,31) |
| InChiKey: | InChIKey=CLFMIWUWBOOJLY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.