* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FMOC-L-PHE(4-CHO) |
| English Synonyms: | FMOC-L-PHE(4-CHO) |
| MDL Number.: | MFCD01860605 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | c1ccc2c(c1)-c3ccccc3C2COC(=O)N[C@@H](Cc4ccc(cc4)C=O)C(=O)O |
| InChi: | InChI=1S/C25H21NO5/c27-14-17-11-9-16(10-12-17)13-23(24(28)29)26-25(30)31-15-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-12,14,22-23H,13,15H2,(H,26,30)(H,28,29)/t23-/m0/s1 |
| InChiKey: | InChIKey=MMUBAFLZITUBHG-QHCPKHFHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.