* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FMOC-L-PHE(4-CH2NIPR-BOC) |
| English Synonyms: | FMOC-L-PHE(4-CH2NIPR-BOC) |
| MDL Number.: | MFCD01860610 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | CC(C)N(Cc1ccc(cc1)C[C@@H](C(=O)O)NC(=O)OCC2c3ccccc3-c4c2cccc4)C(=O)OC(C)(C)C |
| InChi: | InChI=1S/C33H38N2O6/c1-21(2)35(32(39)41-33(3,4)5)19-23-16-14-22(15-17-23)18-29(30(36)37)34-31(38)40-20-28-26-12-8-6-10-24(26)25-11-7-9-13-27(25)28/h6-17,21,28-29H,18-20H2,1-5H3,(H,34,38)(H,36,37)/t29-/m0/s1 |
| InChiKey: | InChIKey=IOYDADPISZMLMH-LJAQVGFWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.